C19H16FNO3S — CID 8942361
[5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl (E)-3-(5-methylthiophen-2-yl)prop-2-enoate (PubChem CID 8942361) has the molecular formula C19H16FNO3S and a molecular weight of 357.41 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl (E)-3-(5-methylthiophen-2-yl)prop-2-enoate.
| Compound Name | [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl (E)-3-(5-methylthiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8942361 |
| Molecular Formula | C19H16FNO3S |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl (E)-3-(5-methylthiophen-2-yl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C/C(=O)OCc2noc(-c3ccc(F)cc3)c2C)s1 |
| InChI | InChI=1S/C19H16FNO3S/c1-12-3-8-16(25-12)9-10-18(22)23-11-17-13(2)19(24-21-17)14-4-6-15(20)7-5-14/h3-10H,11H2,1-2H3/b10-9+ |
| InChIKey | FGMUPHCUHAZFCI-MDZDMXLPSA-N |
| XLogP | 4.92 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|