C20H15FN2O5 — CID 8647820
[5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl (E)-3-(4-nitrophenyl)prop-2-enoate (PubChem CID 8647820) has the molecular formula C20H15FN2O5 and a molecular weight of 382.35 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl (E)-3-(4-nitrophenyl)prop-2-enoate.
| Compound Name | [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl (E)-3-(4-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8647820 |
| Molecular Formula | C20H15FN2O5 |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl (E)-3-(4-nitrophenyl)prop-2-enoate |
| SMILES | Cc1c(COC(=O)/C=C/c2ccc([N+](=O)[O-])cc2)noc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H15FN2O5/c1-13-18(22-28-20(13)15-5-7-16(21)8-6-15)12-27-19(24)11-4-14-2-9-17(10-3-14)23(25)26/h2-11H,12H2,1H3/b11-4+ |
| InChIKey | UQPSNRCNERQLRE-NYYWCZLTSA-N |
| XLogP | 4.45 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|