C20H16FN3O6 — CID 8748919
[5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-[(3-nitrobenzoyl)amino]acetate (PubChem CID 8748919) has the molecular formula C20H16FN3O6 and a molecular weight of 413.36 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-[(3-nitrobenzoyl)amino]acetate.
| Compound Name | [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-[(3-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 8748919 |
| Molecular Formula | C20H16FN3O6 |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | [5-(4-fluorophenyl)-4-methyl-1,2-oxazol-3-yl]methyl 2-[(3-nitrobenzoyl)amino]acetate |
| SMILES | Cc1c(COC(=O)CNC(=O)c2cccc([N+](=O)[O-])c2)noc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H16FN3O6/c1-12-17(23-30-19(12)13-5-7-15(21)8-6-13)11-29-18(25)10-22-20(26)14-3-2-4-16(9-14)24(27)28/h2-9H,10-11H2,1H3,(H,22,26) |
| InChIKey | CRVGDSUPAPNBAE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|