C18H17N5O6 — CID 71845861
(4-amino-5,6-dimethylfuro[2,3-d]pyrimidin-2-yl)methyl 2-[(3-nitrobenzoyl)amino]acetate (PubChem CID 71845861) has the molecular formula C18H17N5O6 and a molecular weight of 399.36 g/mol. Its IUPAC name is (4-amino-5,6-dimethylfuro[2,3-d]pyrimidin-2-yl)methyl 2-[(3-nitrobenzoyl)amino]acetate.
| Compound Name | (4-amino-5,6-dimethylfuro[2,3-d]pyrimidin-2-yl)methyl 2-[(3-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 71845861 |
| Molecular Formula | C18H17N5O6 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | (4-amino-5,6-dimethylfuro[2,3-d]pyrimidin-2-yl)methyl 2-[(3-nitrobenzoyl)amino]acetate |
| SMILES | Cc1oc2nc(COC(=O)CNC(=O)c3cccc([N+](=O)[O-])c3)nc(N)c2c1C |
| InChI | InChI=1S/C18H17N5O6/c1-9-10(2)29-18-15(9)16(19)21-13(22-18)8-28-14(24)7-20-17(25)11-4-3-5-12(6-11)23(26)27/h3-6H,7-8H2,1-2H3,(H,20,25)(H2,19,21,22) |
| InChIKey | WLDQXWJUHCDYQY-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 163.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|