C22H20N4O7S — CID 55316660
[2-[2-(2-methoxyanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 2-[(3-nitrobenzoyl)amino]acetate (PubChem CID 55316660) has the molecular formula C22H20N4O7S and a molecular weight of 484.49 g/mol. Its IUPAC name is [2-[2-(2-methoxyanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 2-[(3-nitrobenzoyl)amino]acetate.
| Compound Name | [2-[2-(2-methoxyanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 2-[(3-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 55316660 |
| Molecular Formula | C22H20N4O7S |
| Molecular Weight | 484.49 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | [2-[2-(2-methoxyanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl 2-[(3-nitrobenzoyl)amino]acetate |
| SMILES | COc1ccccc1NC(=O)Cc1nc(COC(=O)CNC(=O)c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C22H20N4O7S/c1-32-18-8-3-2-7-17(18)25-19(27)10-20-24-15(13-34-20)12-33-21(28)11-23-22(29)14-5-4-6-16(9-14)26(30)31/h2-9,13H,10-12H2,1H3,(H,23,29)(H,25,27) |
| InChIKey | QBZRAFXYQHAQJD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 149.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|