C16H9F5N2O5 — CID 9269769
(2,3,4,5,6-pentafluorophenyl)methyl 2-[(3-nitrobenzoyl)amino]acetate (PubChem CID 9269769) has the molecular formula C16H9F5N2O5 and a molecular weight of 404.25 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl 2-[(3-nitrobenzoyl)amino]acetate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl 2-[(3-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 9269769 |
| Molecular Formula | C16H9F5N2O5 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl 2-[(3-nitrobenzoyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1cccc([N+](=O)[O-])c1)OCc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H9F5N2O5/c17-11-9(12(18)14(20)15(21)13(11)19)6-28-10(24)5-22-16(25)7-2-1-3-8(4-7)23(26)27/h1-4H,5-6H2,(H,22,25) |
| InChIKey | ISGKBIGLQSMZLZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|