C19H20N2O7 — CID 9269466
2-(4-ethoxyphenoxy)ethyl 2-[(3-nitrobenzoyl)amino]acetate (PubChem CID 9269466) has the molecular formula C19H20N2O7 and a molecular weight of 388.38 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)ethyl 2-[(3-nitrobenzoyl)amino]acetate.
| Compound Name | 2-(4-ethoxyphenoxy)ethyl 2-[(3-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 9269466 |
| Molecular Formula | C19H20N2O7 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 2-(4-ethoxyphenoxy)ethyl 2-[(3-nitrobenzoyl)amino]acetate |
| SMILES | CCOc1ccc(OCCOC(=O)CNC(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C19H20N2O7/c1-2-26-16-6-8-17(9-7-16)27-10-11-28-18(22)13-20-19(23)14-4-3-5-15(12-14)21(24)25/h3-9,12H,2,10-11,13H2,1H3,(H,20,23) |
| InChIKey | SCURQPPAMLMPAN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|