C24H24N4O6S — CID 55927892
[2-[2-(2,5-dimethylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl (2S)-2-[(3-nitrobenzoyl)amino]propanoate (PubChem CID 55927892) has the molecular formula C24H24N4O6S and a molecular weight of 496.55 g/mol. Its IUPAC name is [2-[2-(2,5-dimethylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl (2S)-2-[(3-nitrobenzoyl)amino]propanoate.
| Compound Name | [2-[2-(2,5-dimethylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl (2S)-2-[(3-nitrobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 55927892 |
| Molecular Formula | C24H24N4O6S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | [2-[2-(2,5-dimethylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl (2S)-2-[(3-nitrobenzoyl)amino]propanoate |
| SMILES | Cc1ccc(C)c(NC(=O)Cc2nc(COC(=O)[C@H](C)NC(=O)c3cccc([N+](=O)[O-])c3)cs2)c1 |
| InChI | InChI=1S/C24H24N4O6S/c1-14-7-8-15(2)20(9-14)27-21(29)11-22-26-18(13-35-22)12-34-24(31)16(3)25-23(30)17-5-4-6-19(10-17)28(32)33/h4-10,13,16H,11-12H2,1-3H3,(H,25,30)(H,27,29)/t16-/m0/s1 |
| InChIKey | CNNPGIZXJHENBH-INIZCTEOSA-N |
| XLogP | 3.71 |
| TPSA | 140.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|