C26H23N3O3S — CID 55506981
[2-[2-(2,5-dimethylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl (E)-3-quinolin-8-ylprop-2-enoate (PubChem CID 55506981) has the molecular formula C26H23N3O3S and a molecular weight of 457.56 g/mol. Its IUPAC name is [2-[2-(2,5-dimethylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl (E)-3-quinolin-8-ylprop-2-enoate.
| Compound Name | [2-[2-(2,5-dimethylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl (E)-3-quinolin-8-ylprop-2-enoate |
|---|---|
| PubChem CID | 55506981 |
| Molecular Formula | C26H23N3O3S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | [2-[2-(2,5-dimethylanilino)-2-oxoethyl]-1,3-thiazol-4-yl]methyl (E)-3-quinolin-8-ylprop-2-enoate |
| SMILES | Cc1ccc(C)c(NC(=O)Cc2nc(COC(=O)/C=C/c3cccc4cccnc34)cs2)c1 |
| InChI | InChI=1S/C26H23N3O3S/c1-17-8-9-18(2)22(13-17)29-23(30)14-24-28-21(16-33-24)15-32-25(31)11-10-20-6-3-5-19-7-4-12-27-26(19)20/h3-13,16H,14-15H2,1-2H3,(H,29,30)/b11-10+ |
| InChIKey | WIKMITWWNSIIQH-ZHACJKMWSA-N |
| XLogP | 5.25 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|