C24H19ClN2O2 — CID 16608148
(2-chloro-7,8-dimethylquinolin-3-yl)methyl (E)-3-quinolin-8-ylprop-2-enoate (PubChem CID 16608148) has the molecular formula C24H19ClN2O2 and a molecular weight of 402.88 g/mol. Its IUPAC name is (2-chloro-7,8-dimethylquinolin-3-yl)methyl (E)-3-quinolin-8-ylprop-2-enoate.
| Compound Name | (2-chloro-7,8-dimethylquinolin-3-yl)methyl (E)-3-quinolin-8-ylprop-2-enoate |
|---|---|
| PubChem CID | 16608148 |
| Molecular Formula | C24H19ClN2O2 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | (2-chloro-7,8-dimethylquinolin-3-yl)methyl (E)-3-quinolin-8-ylprop-2-enoate |
| SMILES | Cc1ccc2cc(COC(=O)/C=C/c3cccc4cccnc34)c(Cl)nc2c1C |
| InChI | InChI=1S/C24H19ClN2O2/c1-15-8-9-19-13-20(24(25)27-22(19)16(15)2)14-29-21(28)11-10-18-6-3-5-17-7-4-12-26-23(17)18/h3-13H,14H2,1-2H3/b11-10+ |
| InChIKey | RLNQOXPPTYTNGA-ZHACJKMWSA-N |
| XLogP | 5.81 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|