C18H19NO3 — CID 16607648
(3,3-dimethyl-2-oxobutyl) (E)-3-quinolin-8-ylprop-2-enoate (PubChem CID 16607648) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) (E)-3-quinolin-8-ylprop-2-enoate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) (E)-3-quinolin-8-ylprop-2-enoate |
|---|---|
| PubChem CID | 16607648 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) (E)-3-quinolin-8-ylprop-2-enoate |
| SMILES | CC(C)(C)C(=O)COC(=O)/C=C/c1cccc2cccnc12 |
| InChI | InChI=1S/C18H19NO3/c1-18(2,3)15(20)12-22-16(21)10-9-14-7-4-6-13-8-5-11-19-17(13)14/h4-11H,12H2,1-3H3/b10-9+ |
| InChIKey | BJHODIUIONEYEG-MDZDMXLPSA-N |
| XLogP | 3.41 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|