C24H18N2O3 — CID 16607687
[2-(naphthalen-1-ylamino)-2-oxoethyl] (E)-3-quinolin-8-ylprop-2-enoate (PubChem CID 16607687) has the molecular formula C24H18N2O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is [2-(naphthalen-1-ylamino)-2-oxoethyl] (E)-3-quinolin-8-ylprop-2-enoate.
| Compound Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] (E)-3-quinolin-8-ylprop-2-enoate |
|---|---|
| PubChem CID | 16607687 |
| Molecular Formula | C24H18N2O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] (E)-3-quinolin-8-ylprop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cccc2cccnc12)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C24H18N2O3/c27-22(26-21-12-4-7-17-6-1-2-11-20(17)21)16-29-23(28)14-13-19-9-3-8-18-10-5-15-25-24(18)19/h1-15H,16H2,(H,26,27)/b14-13+ |
| InChIKey | UVLCFURSBZAHQK-BUHFOSPRSA-N |
| XLogP | 4.58 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|