C20H12Cl4N2O3 — CID 16607830
[2-oxo-2-(2,3,5,6-tetrachloroanilino)ethyl] (E)-3-quinolin-8-ylprop-2-enoate (PubChem CID 16607830) has the molecular formula C20H12Cl4N2O3 and a molecular weight of 470.14 g/mol. Its IUPAC name is [2-oxo-2-(2,3,5,6-tetrachloroanilino)ethyl] (E)-3-quinolin-8-ylprop-2-enoate.
| Compound Name | [2-oxo-2-(2,3,5,6-tetrachloroanilino)ethyl] (E)-3-quinolin-8-ylprop-2-enoate |
|---|---|
| PubChem CID | 16607830 |
| Molecular Formula | C20H12Cl4N2O3 |
| Molecular Weight | 470.14 g/mol |
| Exact Mass | 467.96 |
| IUPAC Name | [2-oxo-2-(2,3,5,6-tetrachloroanilino)ethyl] (E)-3-quinolin-8-ylprop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cccc2cccnc12)Nc1c(Cl)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C20H12Cl4N2O3/c21-13-9-14(22)18(24)20(17(13)23)26-15(27)10-29-16(28)7-6-12-4-1-3-11-5-2-8-25-19(11)12/h1-9H,10H2,(H,26,27)/b7-6+ |
| InChIKey | NIGKPXVPAFTAQE-VOTSOKGWSA-N |
| XLogP | 6.04 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.14 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|