C20H13Cl3N2O3 — CID 16607705
[2-oxo-2-(2,4,6-trichloroanilino)ethyl] (E)-3-quinolin-8-ylprop-2-enoate (PubChem CID 16607705) has the molecular formula C20H13Cl3N2O3 and a molecular weight of 435.69 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-trichloroanilino)ethyl] (E)-3-quinolin-8-ylprop-2-enoate.
| Compound Name | [2-oxo-2-(2,4,6-trichloroanilino)ethyl] (E)-3-quinolin-8-ylprop-2-enoate |
|---|---|
| PubChem CID | 16607705 |
| Molecular Formula | C20H13Cl3N2O3 |
| Molecular Weight | 435.69 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | [2-oxo-2-(2,4,6-trichloroanilino)ethyl] (E)-3-quinolin-8-ylprop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cccc2cccnc12)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C20H13Cl3N2O3/c21-14-9-15(22)20(16(23)10-14)25-17(26)11-28-18(27)7-6-13-4-1-3-12-5-2-8-24-19(12)13/h1-10H,11H2,(H,25,26)/b7-6+ |
| InChIKey | ZCSVEEDOXFGMOV-VOTSOKGWSA-N |
| XLogP | 5.39 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.69 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|