C24H21N3O4 — CID 16608103
[2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] (E)-3-quinolin-8-ylprop-2-enoate (PubChem CID 16608103) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] (E)-3-quinolin-8-ylprop-2-enoate.
| Compound Name | [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] (E)-3-quinolin-8-ylprop-2-enoate |
|---|---|
| PubChem CID | 16608103 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] (E)-3-quinolin-8-ylprop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cccc2cccnc12)Nc1ccccc1C(=O)NC1CC1 |
| InChI | InChI=1S/C24H21N3O4/c28-21(27-20-9-2-1-8-19(20)24(30)26-18-11-12-18)15-31-22(29)13-10-17-6-3-5-16-7-4-14-25-23(16)17/h1-10,13-14,18H,11-12,15H2,(H,26,30)(H,27,28)/b13-10+ |
| InChIKey | IIRVUCVHEYJHLY-JLHYYAGUSA-N |
| XLogP | 3.32 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|