C21H14ClN3O3 — CID 16608171
[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-3-quinolin-8-ylprop-2-enoate (PubChem CID 16608171) has the molecular formula C21H14ClN3O3 and a molecular weight of 391.81 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-3-quinolin-8-ylprop-2-enoate.
| Compound Name | [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-3-quinolin-8-ylprop-2-enoate |
|---|---|
| PubChem CID | 16608171 |
| Molecular Formula | C21H14ClN3O3 |
| Molecular Weight | 391.81 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-3-quinolin-8-ylprop-2-enoate |
| SMILES | O=C(/C=C/c1cccc2cccnc12)OCc1nc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C21H14ClN3O3/c22-17-9-6-16(7-10-17)21-24-18(28-25-21)13-27-19(26)11-8-15-4-1-3-14-5-2-12-23-20(14)15/h1-12H,13H2/b11-8+ |
| InChIKey | WYEIOGJRVBLFOM-DHZHZOJOSA-N |
| XLogP | 4.69 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.81 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|