C19H12F4N2O3 — CID 46516374
[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl (E)-3-(2-fluorophenyl)prop-2-enoate (PubChem CID 46516374) has the molecular formula C19H12F4N2O3 and a molecular weight of 392.31 g/mol. Its IUPAC name is [3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl (E)-3-(2-fluorophenyl)prop-2-enoate.
| Compound Name | [3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl (E)-3-(2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 46516374 |
| Molecular Formula | C19H12F4N2O3 |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | [3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl (E)-3-(2-fluorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1F)OCc1nc(-c2ccc(C(F)(F)F)cc2)no1 |
| InChI | InChI=1S/C19H12F4N2O3/c20-15-4-2-1-3-12(15)7-10-17(26)27-11-16-24-18(25-28-16)13-5-8-14(9-6-13)19(21,22)23/h1-10H,11H2/b10-7+ |
| InChIKey | QGVIVIUZWSZTJS-JXMROGBWSA-N |
| XLogP | 4.65 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|