C20H15F3N2O4 — CID 32765448
[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl (E)-3-(3-methoxyphenyl)prop-2-enoate (PubChem CID 32765448) has the molecular formula C20H15F3N2O4 and a molecular weight of 404.34 g/mol. Its IUPAC name is [3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl (E)-3-(3-methoxyphenyl)prop-2-enoate.
| Compound Name | [3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl (E)-3-(3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 32765448 |
| Molecular Formula | C20H15F3N2O4 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | [3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl (E)-3-(3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cccc(/C=C/C(=O)OCc2nc(-c3ccc(C(F)(F)F)cc3)no2)c1 |
| InChI | InChI=1S/C20H15F3N2O4/c1-27-16-4-2-3-13(11-16)5-10-18(26)28-12-17-24-19(25-29-17)14-6-8-15(9-7-14)20(21,22)23/h2-11H,12H2,1H3/b10-5+ |
| InChIKey | BBIABTABKFDJFX-BJMVGYQFSA-N |
| XLogP | 4.52 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|