C20H17ClN2O5 — CID 8665460
[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 8665460) has the molecular formula C20H17ClN2O5 and a molecular weight of 400.82 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8665460 |
| Molecular Formula | C20H17ClN2O5 |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-3-(3,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCc2nc(-c3ccc(Cl)cc3)no2)cc(OC)c1 |
| InChI | InChI=1S/C20H17ClN2O5/c1-25-16-9-13(10-17(11-16)26-2)3-8-19(24)27-12-18-22-20(23-28-18)14-4-6-15(21)7-5-14/h3-11H,12H2,1-2H3/b8-3+ |
| InChIKey | FIDUZVFRBPDASE-FPYGCLRLSA-N |
| XLogP | 4.16 |
| TPSA | 83.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|