C18H12ClFN2O3 — CID 8514984
[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-3-(3-fluorophenyl)prop-2-enoate (PubChem CID 8514984) has the molecular formula C18H12ClFN2O3 and a molecular weight of 358.76 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-3-(3-fluorophenyl)prop-2-enoate.
| Compound Name | [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-3-(3-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8514984 |
| Molecular Formula | C18H12ClFN2O3 |
| Molecular Weight | 358.76 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-3-(3-fluorophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cccc(F)c1)OCc1nc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C18H12ClFN2O3/c19-14-7-5-13(6-8-14)18-21-16(25-22-18)11-24-17(23)9-4-12-2-1-3-15(20)10-12/h1-10H,11H2/b9-4+ |
| InChIKey | ONNFQCQFLSCYJO-RUDMXATFSA-N |
| XLogP | 4.29 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.76 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|