C11H9FN2O3 — CID 129267909
[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl acetate (PubChem CID 129267909) has the molecular formula C11H9FN2O3 and a molecular weight of 236.20 g/mol. Its IUPAC name is [3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl acetate.
| Compound Name | [3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl acetate |
|---|---|
| PubChem CID | 129267909 |
| Molecular Formula | C11H9FN2O3 |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | [3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl acetate |
| SMILES | CC(=O)OCc1nc(-c2cccc(F)c2)no1 |
| InChI | InChI=1S/C11H9FN2O3/c1-7(15)16-6-10-13-11(14-17-10)8-3-2-4-9(12)5-8/h2-5H,6H2,1H3 |
| InChIKey | TYELSKPQVOOHTL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |