C11H13FN4O2 — CID 145151193
acetamide;[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methanamine (PubChem CID 145151193) has the molecular formula C11H13FN4O2 and a molecular weight of 252.25 g/mol. Its IUPAC name is acetamide;[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methanamine.
| Compound Name | acetamide;[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 145151193 |
| Molecular Formula | C11H13FN4O2 |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | acetamide;[3-(3-fluorophenyl)-1,2,4-oxadiazol-5-yl]methanamine |
| SMILES | CC(N)=O.NCc1nc(-c2cccc(F)c2)no1 |
| InChI | InChI=1S/C9H8FN3O.C2H5NO/c10-7-3-1-2-6(4-7)9-12-8(5-11)14-13-9;1-2(3)4/h1-4H,5,11H2;1H3,(H2,3,4) |
| InChIKey | KBYWCSXNLBZLSC-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 108.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |