C16H10ClFN2O3 — CID 8764401
(3-phenyl-1,2,4-oxadiazol-5-yl)methyl 2-chloro-4-fluorobenzoate (PubChem CID 8764401) has the molecular formula C16H10ClFN2O3 and a molecular weight of 332.72 g/mol. Its IUPAC name is (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 2-chloro-4-fluorobenzoate.
| Compound Name | (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 2-chloro-4-fluorobenzoate |
|---|---|
| PubChem CID | 8764401 |
| Molecular Formula | C16H10ClFN2O3 |
| Molecular Weight | 332.72 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 2-chloro-4-fluorobenzoate |
| SMILES | O=C(OCc1nc(-c2ccccc2)no1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C16H10ClFN2O3/c17-13-8-11(18)6-7-12(13)16(21)22-9-14-19-15(20-23-14)10-4-2-1-3-5-10/h1-8H,9H2 |
| InChIKey | FFGWJLMOQJTCLX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.72 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |