C16H11ClFN3O3 — CID 16600204
[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-amino-5-chlorobenzoate (PubChem CID 16600204) has the molecular formula C16H11ClFN3O3 and a molecular weight of 347.73 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-amino-5-chlorobenzoate.
| Compound Name | [3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-amino-5-chlorobenzoate |
|---|---|
| PubChem CID | 16600204 |
| Molecular Formula | C16H11ClFN3O3 |
| Molecular Weight | 347.73 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | [3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-amino-5-chlorobenzoate |
| SMILES | Nc1ccc(Cl)cc1C(=O)OCc1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C16H11ClFN3O3/c17-10-3-6-13(19)12(7-10)16(22)23-8-14-20-15(21-24-14)9-1-4-11(18)5-2-9/h1-7H,8,19H2 |
| InChIKey | NHPIIAVPRVJSMW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.73 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|