C17H14IN3O4 — CID 16611773
[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-amino-5-iodobenzoate (PubChem CID 16611773) has the molecular formula C17H14IN3O4 and a molecular weight of 451.22 g/mol. Its IUPAC name is [3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-amino-5-iodobenzoate.
| Compound Name | [3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-amino-5-iodobenzoate |
|---|---|
| PubChem CID | 16611773 |
| Molecular Formula | C17H14IN3O4 |
| Molecular Weight | 451.22 g/mol |
| Exact Mass | 451.00 |
| IUPAC Name | [3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-amino-5-iodobenzoate |
| SMILES | COc1ccc(-c2noc(COC(=O)c3cc(I)ccc3N)n2)cc1 |
| InChI | InChI=1S/C17H14IN3O4/c1-23-12-5-2-10(3-6-12)16-20-15(25-21-16)9-24-17(22)13-8-11(18)4-7-14(13)19/h2-8H,9,19H2,1H3 |
| InChIKey | CCSBTQAHNUPGJG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 100.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.22 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|