C14H10ClN3O3S — CID 18138336
(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl 2-amino-5-chlorobenzoate (PubChem CID 18138336) has the molecular formula C14H10ClN3O3S and a molecular weight of 335.77 g/mol. Its IUPAC name is (3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl 2-amino-5-chlorobenzoate.
| Compound Name | (3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl 2-amino-5-chlorobenzoate |
|---|---|
| PubChem CID | 18138336 |
| Molecular Formula | C14H10ClN3O3S |
| Molecular Weight | 335.77 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | (3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl 2-amino-5-chlorobenzoate |
| SMILES | Nc1ccc(Cl)cc1C(=O)OCc1nc(-c2cccs2)no1 |
| InChI | InChI=1S/C14H10ClN3O3S/c15-8-3-4-10(16)9(6-8)14(19)20-7-12-17-13(18-21-12)11-2-1-5-22-11/h1-6H,7,16H2 |
| InChIKey | PFKDLTPDJYRXDO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.77 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|