C17H13ClN2O3 — CID 8512172
[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-methylbenzoate (PubChem CID 8512172) has the molecular formula C17H13ClN2O3 and a molecular weight of 328.76 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-methylbenzoate.
| Compound Name | [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-methylbenzoate |
|---|---|
| PubChem CID | 8512172 |
| Molecular Formula | C17H13ClN2O3 |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | [3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)OCc1nc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C17H13ClN2O3/c1-11-4-2-3-5-14(11)17(21)22-10-15-19-16(20-23-15)12-6-8-13(18)9-7-12/h2-9H,10H2,1H3 |
| InChIKey | UXRXGJQXBNGIDZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |