C19H19N3O3 — CID 16611757
[3-(4-ethylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-amino-3-methylbenzoate (PubChem CID 16611757) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is [3-(4-ethylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-amino-3-methylbenzoate.
| Compound Name | [3-(4-ethylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-amino-3-methylbenzoate |
|---|---|
| PubChem CID | 16611757 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | [3-(4-ethylphenyl)-1,2,4-oxadiazol-5-yl]methyl 2-amino-3-methylbenzoate |
| SMILES | CCc1ccc(-c2noc(COC(=O)c3cccc(C)c3N)n2)cc1 |
| InChI | InChI=1S/C19H19N3O3/c1-3-13-7-9-14(10-8-13)18-21-16(25-22-18)11-24-19(23)15-6-4-5-12(2)17(15)20/h4-10H,3,11,20H2,1-2H3 |
| InChIKey | PNXFYANJZCKARO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|