C20H19N3O5 — CID 8522473
[3-(4-propan-2-ylphenyl)-1,2,4-oxadiazol-5-yl]methyl 3-methyl-2-nitrobenzoate (PubChem CID 8522473) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is [3-(4-propan-2-ylphenyl)-1,2,4-oxadiazol-5-yl]methyl 3-methyl-2-nitrobenzoate.
| Compound Name | [3-(4-propan-2-ylphenyl)-1,2,4-oxadiazol-5-yl]methyl 3-methyl-2-nitrobenzoate |
|---|---|
| PubChem CID | 8522473 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | [3-(4-propan-2-ylphenyl)-1,2,4-oxadiazol-5-yl]methyl 3-methyl-2-nitrobenzoate |
| SMILES | Cc1cccc(C(=O)OCc2nc(-c3ccc(C(C)C)cc3)no2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H19N3O5/c1-12(2)14-7-9-15(10-8-14)19-21-17(28-22-19)11-27-20(24)16-6-4-5-13(3)18(16)23(25)26/h4-10,12H,11H2,1-3H3 |
| InChIKey | IBMHZRRKGJMJRY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|