C18H12F3N3O5 — CID 32740004
[3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl 3-methyl-2-nitrobenzoate (PubChem CID 32740004) has the molecular formula C18H12F3N3O5 and a molecular weight of 407.30 g/mol. Its IUPAC name is [3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl 3-methyl-2-nitrobenzoate.
| Compound Name | [3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl 3-methyl-2-nitrobenzoate |
|---|---|
| PubChem CID | 32740004 |
| Molecular Formula | C18H12F3N3O5 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | [3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl 3-methyl-2-nitrobenzoate |
| SMILES | Cc1cccc(C(=O)OCc2nc(-c3ccc(C(F)(F)F)cc3)no2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H12F3N3O5/c1-10-3-2-4-13(15(10)24(26)27)17(25)28-9-14-22-16(23-29-14)11-5-7-12(8-6-11)18(19,20)21/h2-8H,9H2,1H3 |
| InChIKey | GVTZNJNQBVOLHP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|