C14H16N2O3 — CID 79474427
ethyl 2-[3-(4-ethylphenyl)-1,2,4-oxadiazol-5-yl]acetate (PubChem CID 79474427) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is ethyl 2-[3-(4-ethylphenyl)-1,2,4-oxadiazol-5-yl]acetate.
| Compound Name | ethyl 2-[3-(4-ethylphenyl)-1,2,4-oxadiazol-5-yl]acetate |
|---|---|
| PubChem CID | 79474427 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | ethyl 2-[3-(4-ethylphenyl)-1,2,4-oxadiazol-5-yl]acetate |
| SMILES | CCOC(=O)Cc1nc(-c2ccc(CC)cc2)no1 |
| InChI | InChI=1S/C14H16N2O3/c1-3-10-5-7-11(8-6-10)14-15-12(19-16-14)9-13(17)18-4-2/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | OKQIUKGQRUIBIY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |