C17H12BrN3O3 — CID 55739685
[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 3-pyridin-2-ylprop-2-enoate (PubChem CID 55739685) has the molecular formula C17H12BrN3O3 and a molecular weight of 386.21 g/mol. Its IUPAC name is [3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 3-pyridin-2-ylprop-2-enoate.
| Compound Name | [3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 3-pyridin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 55739685 |
| Molecular Formula | C17H12BrN3O3 |
| Molecular Weight | 386.21 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | [3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 3-pyridin-2-ylprop-2-enoate |
| SMILES | O=C(C=Cc1ccccn1)OCc1nc(-c2cccc(Br)c2)no1 |
| InChI | InChI=1S/C17H12BrN3O3/c18-13-5-3-4-12(10-13)17-20-15(24-21-17)11-23-16(22)8-7-14-6-1-2-9-19-14/h1-10H,11H2 |
| InChIKey | HSDYSIRKHSSZIV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.21 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|