C16H10BrClN2O3 — CID 9014275
[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 3-chlorobenzoate (PubChem CID 9014275) has the molecular formula C16H10BrClN2O3 and a molecular weight of 393.62 g/mol. Its IUPAC name is [3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 3-chlorobenzoate.
| Compound Name | [3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 3-chlorobenzoate |
|---|---|
| PubChem CID | 9014275 |
| Molecular Formula | C16H10BrClN2O3 |
| Molecular Weight | 393.62 g/mol |
| Exact Mass | 391.96 |
| IUPAC Name | [3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 3-chlorobenzoate |
| SMILES | O=C(OCc1nc(-c2cccc(Br)c2)no1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H10BrClN2O3/c17-12-5-1-3-10(7-12)15-19-14(23-20-15)9-22-16(21)11-4-2-6-13(18)8-11/h1-8H,9H2 |
| InChIKey | CZWAXYUHJMLZKS-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.62 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |