C17H20BrN3O4 — CID 55734481
[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 6-acetamidohexanoate (PubChem CID 55734481) has the molecular formula C17H20BrN3O4 and a molecular weight of 410.27 g/mol. Its IUPAC name is [3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 6-acetamidohexanoate.
| Compound Name | [3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 6-acetamidohexanoate |
|---|---|
| PubChem CID | 55734481 |
| Molecular Formula | C17H20BrN3O4 |
| Molecular Weight | 410.27 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | [3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl 6-acetamidohexanoate |
| SMILES | CC(=O)NCCCCCC(=O)OCc1nc(-c2cccc(Br)c2)no1 |
| InChI | InChI=1S/C17H20BrN3O4/c1-12(22)19-9-4-2-3-8-16(23)24-11-15-20-17(21-25-15)13-6-5-7-14(18)10-13/h5-7,10H,2-4,8-9,11H2,1H3,(H,19,22) |
| InChIKey | YTNUBNKJJHLCSB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|