C20H21BrN2O3 — CID 9339321
[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl adamantane-2-carboxylate (PubChem CID 9339321) has the molecular formula C20H21BrN2O3 and a molecular weight of 417.30 g/mol. Its IUPAC name is [3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl adamantane-2-carboxylate.
| Compound Name | [3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl adamantane-2-carboxylate |
|---|---|
| PubChem CID | 9339321 |
| Molecular Formula | C20H21BrN2O3 |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | [3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl adamantane-2-carboxylate |
| SMILES | O=C(OCc1nc(-c2cccc(Br)c2)no1)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C20H21BrN2O3/c21-16-3-1-2-13(9-16)19-22-17(26-23-19)10-25-20(24)18-14-5-11-4-12(7-14)8-15(18)6-11/h1-3,9,11-12,14-15,18H,4-8,10H2 |
| InChIKey | JFJLEGBBARZMMI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |