C16H15BrN2O3 — CID 46608364
[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl cyclohex-3-ene-1-carboxylate (PubChem CID 46608364) has the molecular formula C16H15BrN2O3 and a molecular weight of 363.21 g/mol. Its IUPAC name is [3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl cyclohex-3-ene-1-carboxylate.
| Compound Name | [3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 46608364 |
| Molecular Formula | C16H15BrN2O3 |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | [3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl cyclohex-3-ene-1-carboxylate |
| SMILES | O=C(OCc1nc(-c2cccc(Br)c2)no1)C1CC=CCC1 |
| InChI | InChI=1S/C16H15BrN2O3/c17-13-8-4-7-12(9-13)15-18-14(22-19-15)10-21-16(20)11-5-2-1-3-6-11/h1-2,4,7-9,11H,3,5-6,10H2 |
| InChIKey | QHCMPJYPSAMMAY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|