C17H12ClN3O5 — CID 9417957
[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl 3-methyl-4-nitrobenzoate (PubChem CID 9417957) has the molecular formula C17H12ClN3O5 and a molecular weight of 373.75 g/mol. Its IUPAC name is [3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl 3-methyl-4-nitrobenzoate.
| Compound Name | [3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl 3-methyl-4-nitrobenzoate |
|---|---|
| PubChem CID | 9417957 |
| Molecular Formula | C17H12ClN3O5 |
| Molecular Weight | 373.75 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | [3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl 3-methyl-4-nitrobenzoate |
| SMILES | Cc1cc(C(=O)OCc2nc(-c3cccc(Cl)c3)no2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H12ClN3O5/c1-10-7-12(5-6-14(10)21(23)24)17(22)25-9-15-19-16(20-26-15)11-3-2-4-13(18)8-11/h2-8H,9H2,1H3 |
| InChIKey | JVTRRXVLJOYELS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.75 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|