C18H12F3N3O5S — CID 18271851
[3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl 4-methylsulfanyl-3-nitrobenzoate (PubChem CID 18271851) has the molecular formula C18H12F3N3O5S and a molecular weight of 439.37 g/mol. Its IUPAC name is [3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl 4-methylsulfanyl-3-nitrobenzoate.
| Compound Name | [3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl 4-methylsulfanyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 18271851 |
| Molecular Formula | C18H12F3N3O5S |
| Molecular Weight | 439.37 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | [3-[3-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl]methyl 4-methylsulfanyl-3-nitrobenzoate |
| SMILES | CSc1ccc(C(=O)OCc2nc(-c3cccc(C(F)(F)F)c3)no2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H12F3N3O5S/c1-30-14-6-5-11(8-13(14)24(26)27)17(25)28-9-15-22-16(23-29-15)10-3-2-4-12(7-10)18(19,20)21/h2-8H,9H2,1H3 |
| InChIKey | VLGXDWCGNKZRHC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.37 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|