C18H15N3O7 — CID 8708201
[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 4-methoxy-3-nitrobenzoate (PubChem CID 8708201) has the molecular formula C18H15N3O7 and a molecular weight of 385.33 g/mol. Its IUPAC name is [3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 4-methoxy-3-nitrobenzoate.
| Compound Name | [3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 4-methoxy-3-nitrobenzoate |
|---|---|
| PubChem CID | 8708201 |
| Molecular Formula | C18H15N3O7 |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | [3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 4-methoxy-3-nitrobenzoate |
| SMILES | COc1cccc(-c2noc(COC(=O)c3ccc(OC)c([N+](=O)[O-])c3)n2)c1 |
| InChI | InChI=1S/C18H15N3O7/c1-25-13-5-3-4-11(8-13)17-19-16(28-20-17)10-27-18(22)12-6-7-15(26-2)14(9-12)21(23)24/h3-9H,10H2,1-2H3 |
| InChIKey | LKKPZLWNFOYBJV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 126.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|