C16H12ClN3O4 — CID 8017406
[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 6-chloropyridine-3-carboxylate (PubChem CID 8017406) has the molecular formula C16H12ClN3O4 and a molecular weight of 345.74 g/mol. Its IUPAC name is [3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 6-chloropyridine-3-carboxylate.
| Compound Name | [3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 8017406 |
| Molecular Formula | C16H12ClN3O4 |
| Molecular Weight | 345.74 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | [3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 6-chloropyridine-3-carboxylate |
| SMILES | COc1cccc(-c2noc(COC(=O)c3ccc(Cl)nc3)n2)c1 |
| InChI | InChI=1S/C16H12ClN3O4/c1-22-12-4-2-3-10(7-12)15-19-14(24-20-15)9-23-16(21)11-5-6-13(17)18-8-11/h2-8H,9H2,1H3 |
| InChIKey | JVHBKYCOSUJTPN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 87.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.74 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|