C17H12ClF2N3O5 — CID 46810146
[3-[4-(difluoromethoxy)-3-methoxyphenyl]-1,2,4-oxadiazol-5-yl]methyl 6-chloropyridine-3-carboxylate (PubChem CID 46810146) has the molecular formula C17H12ClF2N3O5 and a molecular weight of 411.75 g/mol. Its IUPAC name is [3-[4-(difluoromethoxy)-3-methoxyphenyl]-1,2,4-oxadiazol-5-yl]methyl 6-chloropyridine-3-carboxylate.
| Compound Name | [3-[4-(difluoromethoxy)-3-methoxyphenyl]-1,2,4-oxadiazol-5-yl]methyl 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 46810146 |
| Molecular Formula | C17H12ClF2N3O5 |
| Molecular Weight | 411.75 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | [3-[4-(difluoromethoxy)-3-methoxyphenyl]-1,2,4-oxadiazol-5-yl]methyl 6-chloropyridine-3-carboxylate |
| SMILES | COc1cc(-c2noc(COC(=O)c3ccc(Cl)nc3)n2)ccc1OC(F)F |
| InChI | InChI=1S/C17H12ClF2N3O5/c1-25-12-6-9(2-4-11(12)27-17(19)20)15-22-14(28-23-15)8-26-16(24)10-3-5-13(18)21-7-10/h2-7,17H,8H2,1H3 |
| InChIKey | OJYYLPJNVYKMCS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 96.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.75 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|