C17H11Cl2F2N3O5 — CID 46810215
[3-[4-(difluoromethoxy)-3-methoxyphenyl]-1,2,4-oxadiazol-5-yl]methyl 5,6-dichloropyridine-3-carboxylate (PubChem CID 46810215) has the molecular formula C17H11Cl2F2N3O5 and a molecular weight of 446.19 g/mol. Its IUPAC name is [3-[4-(difluoromethoxy)-3-methoxyphenyl]-1,2,4-oxadiazol-5-yl]methyl 5,6-dichloropyridine-3-carboxylate.
| Compound Name | [3-[4-(difluoromethoxy)-3-methoxyphenyl]-1,2,4-oxadiazol-5-yl]methyl 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 46810215 |
| Molecular Formula | C17H11Cl2F2N3O5 |
| Molecular Weight | 446.19 g/mol |
| Exact Mass | 445.00 |
| IUPAC Name | [3-[4-(difluoromethoxy)-3-methoxyphenyl]-1,2,4-oxadiazol-5-yl]methyl 5,6-dichloropyridine-3-carboxylate |
| SMILES | COc1cc(-c2noc(COC(=O)c3cnc(Cl)c(Cl)c3)n2)ccc1OC(F)F |
| InChI | InChI=1S/C17H11Cl2F2N3O5/c1-26-12-5-8(2-3-11(12)28-17(20)21)15-23-13(29-24-15)7-27-16(25)9-4-10(18)14(19)22-6-9/h2-6,17H,7H2,1H3 |
| InChIKey | LHLQFQKIZRDTCZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 96.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.19 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|