C18H13N3O4 — CID 8018261
[3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 4-cyanobenzoate (PubChem CID 8018261) has the molecular formula C18H13N3O4 and a molecular weight of 335.32 g/mol. Its IUPAC name is [3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 4-cyanobenzoate.
| Compound Name | [3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 4-cyanobenzoate |
|---|---|
| PubChem CID | 8018261 |
| Molecular Formula | C18H13N3O4 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | [3-(3-methoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl 4-cyanobenzoate |
| SMILES | COc1cccc(-c2noc(COC(=O)c3ccc(C#N)cc3)n2)c1 |
| InChI | InChI=1S/C18H13N3O4/c1-23-15-4-2-3-14(9-15)17-20-16(25-21-17)11-24-18(22)13-7-5-12(10-19)6-8-13/h2-9H,11H2,1H3 |
| InChIKey | GHXITFPPXHOGLL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 98.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |