C13H12N2O5S — CID 7630410
(5-methyl-1,2-oxazol-3-yl)methyl 4-methylsulfanyl-3-nitrobenzoate (PubChem CID 7630410) has the molecular formula C13H12N2O5S and a molecular weight of 308.32 g/mol. Its IUPAC name is (5-methyl-1,2-oxazol-3-yl)methyl 4-methylsulfanyl-3-nitrobenzoate.
| Compound Name | (5-methyl-1,2-oxazol-3-yl)methyl 4-methylsulfanyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 7630410 |
| Molecular Formula | C13H12N2O5S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | (5-methyl-1,2-oxazol-3-yl)methyl 4-methylsulfanyl-3-nitrobenzoate |
| SMILES | CSc1ccc(C(=O)OCc2cc(C)on2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H12N2O5S/c1-8-5-10(14-20-8)7-19-13(16)9-3-4-12(21-2)11(6-9)15(17)18/h3-6H,7H2,1-2H3 |
| InChIKey | SUOWPZOQBAJSKE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|