C17H14ClNO6S — CID 7630406
(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl 4-methylsulfanyl-3-nitrobenzoate (PubChem CID 7630406) has the molecular formula C17H14ClNO6S and a molecular weight of 395.82 g/mol. Its IUPAC name is (5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl 4-methylsulfanyl-3-nitrobenzoate.
| Compound Name | (5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl 4-methylsulfanyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 7630406 |
| Molecular Formula | C17H14ClNO6S |
| Molecular Weight | 395.82 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | (5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl 4-methylsulfanyl-3-nitrobenzoate |
| SMILES | CSc1ccc(C(=O)OCc2cc(Cl)c3c(c2)OCCO3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14ClNO6S/c1-26-15-3-2-11(8-13(15)19(21)22)17(20)25-9-10-6-12(18)16-14(7-10)23-4-5-24-16/h2-3,6-8H,4-5,9H2,1H3 |
| InChIKey | QXFJWZWXMPLXBC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.82 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|