C19H16ClNO8 — CID 18193298
3-O-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl] 1-O-ethyl 5-nitrobenzene-1,3-dicarboxylate (PubChem CID 18193298) has the molecular formula C19H16ClNO8 and a molecular weight of 421.79 g/mol. Its IUPAC name is 3-O-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl] 1-O-ethyl 5-nitrobenzene-1,3-dicarboxylate.
| Compound Name | 3-O-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl] 1-O-ethyl 5-nitrobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 18193298 |
| Molecular Formula | C19H16ClNO8 |
| Molecular Weight | 421.79 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | 3-O-[(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)methyl] 1-O-ethyl 5-nitrobenzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)OCc2cc(Cl)c3c(c2)OCCO3)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H16ClNO8/c1-2-26-18(22)12-7-13(9-14(8-12)21(24)25)19(23)29-10-11-5-15(20)17-16(6-11)27-3-4-28-17/h5-9H,2-4,10H2,1H3 |
| InChIKey | HSUASDSVXLAJPJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.79 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|