C18H21N3O5 — CID 7593740
(5-methyl-1,2-oxazol-3-yl)methyl 4-[(3S)-3-methylpiperidin-1-yl]-3-nitrobenzoate (PubChem CID 7593740) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is (5-methyl-1,2-oxazol-3-yl)methyl 4-[(3S)-3-methylpiperidin-1-yl]-3-nitrobenzoate.
| Compound Name | (5-methyl-1,2-oxazol-3-yl)methyl 4-[(3S)-3-methylpiperidin-1-yl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 7593740 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | (5-methyl-1,2-oxazol-3-yl)methyl 4-[(3S)-3-methylpiperidin-1-yl]-3-nitrobenzoate |
| SMILES | Cc1cc(COC(=O)c2ccc(N3CCC[C@H](C)C3)c([N+](=O)[O-])c2)no1 |
| InChI | InChI=1S/C18H21N3O5/c1-12-4-3-7-20(10-12)16-6-5-14(9-17(16)21(23)24)18(22)25-11-15-8-13(2)26-19-15/h5-6,8-9,12H,3-4,7,10-11H2,1-2H3/t12-/m0/s1 |
| InChIKey | JGYHYTCVUVUUIE-LBPRGKRZSA-N |
| XLogP | 3.48 |
| TPSA | 98.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|