C17H21N3O4 — CID 43016206
3-cyanopropyl 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate (PubChem CID 43016206) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is 3-cyanopropyl 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate.
| Compound Name | 3-cyanopropyl 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 43016206 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 3-cyanopropyl 4-(3-methylpiperidin-1-yl)-3-nitrobenzoate |
| SMILES | CC1CCCN(c2ccc(C(=O)OCCCC#N)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C17H21N3O4/c1-13-5-4-9-19(12-13)15-7-6-14(11-16(15)20(22)23)17(21)24-10-3-2-8-18/h6-7,11,13H,2-5,9-10,12H2,1H3 |
| InChIKey | BFEGCJREIROUOT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 96.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|