C18H24N2O5 — CID 124838931
[(2R)-oxolan-2-yl]methyl 4-[(3R)-3-methylpiperidin-1-yl]-3-nitrobenzoate (PubChem CID 124838931) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is [(2R)-oxolan-2-yl]methyl 4-[(3R)-3-methylpiperidin-1-yl]-3-nitrobenzoate.
| Compound Name | [(2R)-oxolan-2-yl]methyl 4-[(3R)-3-methylpiperidin-1-yl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 124838931 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | [(2R)-oxolan-2-yl]methyl 4-[(3R)-3-methylpiperidin-1-yl]-3-nitrobenzoate |
| SMILES | C[C@@H]1CCCN(c2ccc(C(=O)OC[C@H]3CCCO3)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C18H24N2O5/c1-13-4-2-8-19(11-13)16-7-6-14(10-17(16)20(22)23)18(21)25-12-15-5-3-9-24-15/h6-7,10,13,15H,2-5,8-9,11-12H2,1H3/t13-,15-/m1/s1 |
| InChIKey | PWKGYMOFCJXUKO-UKRRQHHQSA-N |
| XLogP | 3.17 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|