C19H22N4O5 — CID 7753820
[(3S)-3-cyano-4-imino-2-oxopentyl] 4-[(3R)-3-methylpiperidin-1-yl]-3-nitrobenzoate (PubChem CID 7753820) has the molecular formula C19H22N4O5 and a molecular weight of 386.41 g/mol. Its IUPAC name is [(3S)-3-cyano-4-imino-2-oxopentyl] 4-[(3R)-3-methylpiperidin-1-yl]-3-nitrobenzoate.
| Compound Name | [(3S)-3-cyano-4-imino-2-oxopentyl] 4-[(3R)-3-methylpiperidin-1-yl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 7753820 |
| Molecular Formula | C19H22N4O5 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | [(3S)-3-cyano-4-imino-2-oxopentyl] 4-[(3R)-3-methylpiperidin-1-yl]-3-nitrobenzoate |
| SMILES | [H]/N=C(\C)[C@@H](C#N)C(=O)COC(=O)c1ccc(N2CCC[C@@H](C)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H22N4O5/c1-12-4-3-7-22(10-12)16-6-5-14(8-17(16)23(26)27)19(25)28-11-18(24)15(9-20)13(2)21/h5-6,8,12,15,21H,3-4,7,10-11H2,1-2H3/b21-13+/t12-,15-/m1/s1 |
| InChIKey | QRSCDVCCWBZRBZ-WGVQBJKHSA-N |
| XLogP | 2.74 |
| TPSA | 137.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|